Products 13734-32-2

CAS 13734-32-2 is the registry number for Boc-n-methyl-dl-leucine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

4-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoic acid (CAS 13734-32-2) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: 4-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoic acid. InChIKey: YXJFAOXATCRIKU-UHFFFAOYSA-N.

Identity
Molecular formulaC12H23NO4
Molecular weight245.32 g/mol
IUPAC name4-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoic acid
InChIKeyYXJFAOXATCRIKU-UHFFFAOYSA-N
SMILESCC(C)CC(C(=O)O)N(C)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)