CAS 89536-84-5 appears in our catalog under these names: N–(tert–Butoxycarbonyl)–N–methyl–D–leucine, Boc-D-MeLeu-OH, Boc-D-N-Me-Leu-OH 97%, (R)-2-((tert-Butoxycarbonyl)(methyl)amino)-4-methylpentanoic acid, 97%, 97%, N-(tert-Butoxycarbonyl)-N-methyl-D-leucine, 99.81%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10g, 25g, 5g, 1g, 100g, 50g, 100 g, 1 g.
(2R)-4-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoic acid (CAS 89536-84-5) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: (2R)-4-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoic acid. InChIKey: YXJFAOXATCRIKU-SECBINFHSA-N.
| Molecular formula | C12H23NO4 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | (2R)-4-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoic acid |
| InChIKey | YXJFAOXATCRIKU-SECBINFHSA-N |
| SMILES | CC(C)C[C@H](C(=O)O)N(C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)