CAS 1374423-01-4 appears in our catalog under these names: 1-Methyl-6-nitro-2,3-dihydro-1h-indol-2-one, 95%, 1-Methyl-6-nitroindolin-2-one, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 10g, 1g.
1-methyl-6-nitro-3H-indol-2-one (CAS 1374423-01-4) is a chemical compound with the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. IUPAC name: 1-methyl-6-nitro-3H-indol-2-one. InChIKey: RWDCBOPMGNVVOV-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 1-methyl-6-nitro-3H-indol-2-one |
| InChIKey | RWDCBOPMGNVVOV-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CC2=C1C=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)