CAS 1374652-47-7 appears in our catalog under these names: 3-Chloroisoquinolin-5-ol, 95%, 3-Chloroisoquinolin-5-ol, 95+%, 3-Chloroisoquinolin-5-ol, 3-Chloroisoquinolin-5-ol, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 50mg, 0,5g, 100mg.
3-chloroisoquinolin-5-ol (CAS 1374652-47-7) is a chemical compound with the molecular formula C9H6ClNO and a molecular weight of 179.60 g/mol. IUPAC name: 3-chloroisoquinolin-5-ol. InChIKey: BSLJLTVUTCQZLC-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 3-chloroisoquinolin-5-ol |
| InChIKey | BSLJLTVUTCQZLC-UHFFFAOYSA-N |
| SMILES | C1=CC2=CN=C(C=C2C(=C1)O)Cl |
Computed by PubChem (NCBI)