Products 1375473-08-7

CAS 1375473-08-7 appears in our catalog under these names: 2,2-Difluoro-2-(5-fluoro-2-methoxyphenyl)acetic acid, 95%, 2,2-Difluoro-2-(5-fluoro-2-methoxyphenyl)acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

2,2-difluoro-2-(5-fluoro-2-methoxyphenyl)acetic acid (CAS 1375473-08-7) is a chemical compound with the molecular formula C9H7F3O3 and a molecular weight of 220.14 g/mol. IUPAC name: 2,2-difluoro-2-(5-fluoro-2-methoxyphenyl)acetic acid. InChIKey: SPFGBWKTEVKCCJ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7F3O3
Molecular weight220.14 g/mol
IUPAC name2,2-difluoro-2-(5-fluoro-2-methoxyphenyl)acetic acid
InChIKeySPFGBWKTEVKCCJ-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)F)C(C(=O)O)(F)F

Computed by PubChem (NCBI)