Products 1375473-53-2
CAS 1375473-53-2 is the registry number for 2-Phenyl-2-(pyrrolidin-2-yl)acetonitrile hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-phenyl-2-pyrrolidin-2-ylacetonitrile;hydrochloride (CAS 1375473-53-2) is a chemical compound with the molecular formula C12H15ClN2 and a molecular weight of 222.71 g/mol. IUPAC name: 2-phenyl-2-pyrrolidin-2-ylacetonitrile;hydrochloride. InChIKey: NSZJZJLKYBGJDD-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2 |
|---|---|
| Molecular weight | 222.71 g/mol |
| IUPAC name | 2-phenyl-2-pyrrolidin-2-ylacetonitrile;hydrochloride |
| InChIKey | NSZJZJLKYBGJDD-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)C(C#N)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)