Products 2411306-18-6
CAS 2411306-18-6 is the registry number for 4-(2,5-Dimethyl-1h-pyrrol-1-yl)aniline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
4-(2,5-dimethylpyrrol-1-yl)aniline;hydrochloride (CAS 2411306-18-6) is a chemical compound with the molecular formula C12H15ClN2 and a molecular weight of 222.71 g/mol. IUPAC name: 4-(2,5-dimethylpyrrol-1-yl)aniline;hydrochloride. InChIKey: GXXKSUPMVMSZFB-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2 |
|---|---|
| Molecular weight | 222.71 g/mol |
| IUPAC name | 4-(2,5-dimethylpyrrol-1-yl)aniline;hydrochloride |
| InChIKey | GXXKSUPMVMSZFB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(N1C2=CC=C(C=C2)N)C.Cl |
Computed by PubChem (NCBI)