CAS 1784192-75-1 is the registry number for 6-Chloro-1'-methylspiro[indoline-3,3'-pyrrolidine], 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-1'-methylspiro[1,2-dihydroindole-3,3'-pyrrolidine] (CAS 1784192-75-1) is a chemical compound with the molecular formula C12H15ClN2 and a molecular weight of 222.71 g/mol. IUPAC name: 6-chloro-1'-methylspiro[1,2-dihydroindole-3,3'-pyrrolidine]. InChIKey: HYYGPPJZWHGYTI-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2 |
|---|---|
| Molecular weight | 222.71 g/mol |
| IUPAC name | 6-chloro-1'-methylspiro[1,2-dihydroindole-3,3'-pyrrolidine] |
| InChIKey | HYYGPPJZWHGYTI-UHFFFAOYSA-N |
| SMILES | CN1CCC2(C1)CNC3=C2C=CC(=C3)Cl |
Computed by PubChem (NCBI)