CAS 51304-58-6 appears in our catalog under these names: 4-Cyano-4-phenylpiperidine hydrochloride, 96%, 4-Cyano-4-phenylpiperidine hydrochloride, 97% , 4-Cyano-4-phenylpiperidine hydrochloride, 4-CYANO-4-PHENYLPIPERIDINE HYDROCHLORID, 4-Piperidinecarbonitrile, 4-phenyl-, hydrochloride (1:1), 97%, 97%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Biosynth, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 5g, 10g, 0,25g, 2,5g, 100mg, 250mg.
4-phenylpiperidine-4-carbonitrile;hydrochloride (CAS 51304-58-6) is a chemical compound with the molecular formula C12H15ClN2 and a molecular weight of 222.71 g/mol. IUPAC name: 4-phenylpiperidine-4-carbonitrile;hydrochloride. InChIKey: CQPHZBOPSZGTJM-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2 |
|---|---|
| Molecular weight | 222.71 g/mol |
| IUPAC name | 4-phenylpiperidine-4-carbonitrile;hydrochloride |
| InChIKey | CQPHZBOPSZGTJM-UHFFFAOYSA-N |
| SMILES | C1CNCCC1(C#N)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)