CAS 6678-82-6 is the registry number for 1-Methyl-1h,2h,3h,4h,9h-pyrido[3,4-b]indole hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride (CAS 6678-82-6) is a chemical compound with the molecular formula C12H15ClN2 and a molecular weight of 222.71 g/mol. IUPAC name: 1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride. InChIKey: CWQORCGWGWEVEL-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2 |
|---|---|
| Molecular weight | 222.71 g/mol |
| IUPAC name | 1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride |
| InChIKey | CWQORCGWGWEVEL-UHFFFAOYSA-N |
| SMILES | CC1C2=C(CCN1)C3=CC=CC=C3N2.Cl |
Computed by PubChem (NCBI)