Products 13756-40-6
CAS 13756-40-6 appears in our catalog under these names: 4-Nitro-benzoic acid isopropyl ester, 95%, Isopropyl 4-nitrobenzoate, 97%, Isopropyl 4-nitrobenzoate, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
Propan-2-yl 4-nitrobenzoate (CAS 13756-40-6) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: propan-2-yl 4-nitrobenzoate. InChIKey: JSZSPHFHMMXJEU-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | propan-2-yl 4-nitrobenzoate |
| InChIKey | JSZSPHFHMMXJEU-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
Isopropyl 4-nitrobenzoate, propan-2-yl 4-nitrobenzoate, Benzoic acid, 4-nitro-, 1-methylethyl ester, 4-Nitro-benzoic acid isopropyl ester, 4-Nitrobenzoic acid, isopropyl ester, Isopropyl4-nitrobenzoate, Isopropyl p-nitrobenzoate, Benzoicacid, 4-nitro-, 1-methylethyl ester, methylethyl 4-nitrobenzoate, 1-methylethyl 4-nitrobenzoate