Products 1375964-39-8
CAS 1375964-39-8 appears in our catalog under these names: 3–Bromo–2–fluorophenylacetic acid, 3-Bromo-2-fluorophenylacetic acid, 3-Bromo-2-fluorophenylacetic acid 98%, 3-Bromo-2-fluorophenylacetic acid, 97%, 97%, 3-Bromo-2-fluorophenylacetic acid, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 25g, 10g.
2-(3-bromo-2-fluorophenyl)acetic acid (CAS 1375964-39-8) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: 2-(3-bromo-2-fluorophenyl)acetic acid. InChIKey: PAWQVTBBRAZDMG-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | 2-(3-bromo-2-fluorophenyl)acetic acid |
| InChIKey | PAWQVTBBRAZDMG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)F)CC(=O)O |
Computed by PubChem (NCBI)