CAS 137698-08-9 appears in our catalog under these names: Acetylcysteine Impurity 8, Acetylcysteine Impurity 31, Acetylcysteine Impurity 6. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(2R)-2-acetamido-3-(3-amino-2-hydroxy-3-oxopropyl)sulfanylpropanoic acid (CAS 137698-08-9) is a chemical compound with the molecular formula C8H14N2O5S and a molecular weight of 250.27 g/mol. IUPAC name: (2R)-2-acetamido-3-(3-amino-2-hydroxy-3-oxopropyl)sulfanylpropanoic acid. InChIKey: GFVUOIIZUCFXSF-ZBHICJROSA-N.
| Molecular formula | C8H14N2O5S |
|---|---|
| Molecular weight | 250.27 g/mol |
| IUPAC name | (2R)-2-acetamido-3-(3-amino-2-hydroxy-3-oxopropyl)sulfanylpropanoic acid |
| InChIKey | GFVUOIIZUCFXSF-ZBHICJROSA-N |
| SMILES | CC(=O)N[C@@H](CSCC(C(=O)N)O)C(=O)O |
Computed by PubChem (NCBI)