CAS 93841-25-9 appears in our catalog under these names: 2-(2,5-Diaminophenyl)ethanol sulfate, 95%, 2-(2,5-Diaminophenyl)ethanol sulfate, 2-(2,5-diaminophenyl)ethanol Sulfate, >95% (HPLC), 2–(2–Hydroxy)ethyl–p–phenylene diamino sulfate, Hydroxethyl-p-phenylenediamine sulfate, 98.00%. Offered by: AmBeed, Dr. Ehrenstorfer, TRC, GLPBio, Chemat. Available pack sizes: 1g, 50mg, 100mg, 500mg, 25g, 5g, 10g.
2-(2,5-diaminophenyl)ethanol;sulfuric acid (CAS 93841-25-9) is a chemical compound with the molecular formula C8H14N2O5S and a molecular weight of 250.27 g/mol. IUPAC name: 2-(2,5-diaminophenyl)ethanol;sulfuric acid. InChIKey: VBSLNFWECRRALP-UHFFFAOYSA-N.
| Molecular formula | C8H14N2O5S |
|---|---|
| Molecular weight | 250.27 g/mol |
| IUPAC name | 2-(2,5-diaminophenyl)ethanol;sulfuric acid |
| InChIKey | VBSLNFWECRRALP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)CCO)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)