CAS 2060047-28-9 appears in our catalog under these names: (3-(Azetidin-3-yl)-1,2-oxazol-5-yl)methanol, methanesulfonic acid, 95%, (3-(Azetidin-3-yl)-1,2-oxazol-5-yl)methanol, methanesulfonic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
[3-(azetidin-3-yl)-1,2-oxazol-5-yl]methanol;methanesulfonic acid (CAS 2060047-28-9) is a chemical compound with the molecular formula C8H14N2O5S and a molecular weight of 250.27 g/mol. IUPAC name: [3-(azetidin-3-yl)-1,2-oxazol-5-yl]methanol;methanesulfonic acid. InChIKey: PLWDHLKBCSYOGB-UHFFFAOYSA-N.
| Molecular formula | C8H14N2O5S |
|---|---|
| Molecular weight | 250.27 g/mol |
| IUPAC name | [3-(azetidin-3-yl)-1,2-oxazol-5-yl]methanol;methanesulfonic acid |
| InChIKey | PLWDHLKBCSYOGB-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)O.C1C(CN1)C2=NOC(=C2)CO |
Computed by PubChem (NCBI)