CAS 137698-09-0 is the registry number for N-Acetyl-S-(1-carbamoyl-2-hydroxyethyl)-L-cysteine. Offered by: TRC. Available pack sizes: 100mg.
(2R)-2-acetamido-3-(1-amino-3-hydroxy-1-oxopropan-2-yl)sulfanylpropanoic acid (CAS 137698-09-0) is a chemical compound with the molecular formula C8H14N2O5S and a molecular weight of 250.27 g/mol. IUPAC name: (2R)-2-acetamido-3-(1-amino-3-hydroxy-1-oxopropan-2-yl)sulfanylpropanoic acid. InChIKey: BPWCIZNAHHZFRX-ZBHICJROSA-N.
| Molecular formula | C8H14N2O5S |
|---|---|
| Molecular weight | 250.27 g/mol |
| IUPAC name | (2R)-2-acetamido-3-(1-amino-3-hydroxy-1-oxopropan-2-yl)sulfanylpropanoic acid |
| InChIKey | BPWCIZNAHHZFRX-ZBHICJROSA-N |
| SMILES | CC(=O)N[C@@H](CSC(CO)C(=O)N)C(=O)O |
Computed by PubChem (NCBI)