Products 68015-98-5
CAS 68015-98-5 is the registry number for 4-Ethoxybenzene-1,3-diamine sulfate, 97%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 5g, 100g, 25g, 10g, 1g, on request.
4-ethoxybenzene-1,3-diamine;sulfuric acid (CAS 68015-98-5) is a chemical compound with the molecular formula C8H14N2O5S and a molecular weight of 250.27 g/mol. IUPAC name: 4-ethoxybenzene-1,3-diamine;sulfuric acid. InChIKey: WRYXZLYZWDZVKS-UHFFFAOYSA-N.
| Molecular formula | C8H14N2O5S |
|---|---|
| Molecular weight | 250.27 g/mol |
| IUPAC name | 4-ethoxybenzene-1,3-diamine;sulfuric acid |
| InChIKey | WRYXZLYZWDZVKS-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)N)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Ethoxy-m-phenylenediamine sulfate, C.I. oxidation base 14A, RODOL EOX, m-Phenylenediamine, 4-ethoxy-, sulfate, 4-Ethoxybenzene-1,3-diammonium sulphate, 4Ethoxymphenylenediamine sulfate, 4Ethoxybenzene1,3diammonium sulphate, 4-Ethoxybenzene-1,3-diamine sulfate, 2,4-Diamino phenetole sulfate, 4-ethoxybenzene-1,3-diamine;sulfuric acid