CAS 13771-99-8 is the registry number for 1-(5-Chlorobenzo[b]thien-2-yl)ethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
1-(5-chloro-1-benzothiophen-2-yl)ethanone (CAS 13771-99-8) is a chemical compound with the molecular formula C10H7ClOS and a molecular weight of 210.68 g/mol. IUPAC name: 1-(5-chloro-1-benzothiophen-2-yl)ethanone. InChIKey: MSTSKWLOJUPTEH-UHFFFAOYSA-N.
| Molecular formula | C10H7ClOS |
|---|---|
| Molecular weight | 210.68 g/mol |
| IUPAC name | 1-(5-chloro-1-benzothiophen-2-yl)ethanone |
| InChIKey | MSTSKWLOJUPTEH-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(S1)C=CC(=C2)Cl |
Computed by PubChem (NCBI)