CAS 50451-78-0 is the registry number for 5-Chloro-3-methylbenzo[b]thiophene-2-carbaldehyde, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
5-chloro-3-methyl-1-benzothiophene-2-carbaldehyde (CAS 50451-78-0) is a chemical compound with the molecular formula C10H7ClOS and a molecular weight of 210.68 g/mol. IUPAC name: 5-chloro-3-methyl-1-benzothiophene-2-carbaldehyde. InChIKey: OEHWRIDKBQTMPG-UHFFFAOYSA-N.
| Molecular formula | C10H7ClOS |
|---|---|
| Molecular weight | 210.68 g/mol |
| IUPAC name | 5-chloro-3-methyl-1-benzothiophene-2-carbaldehyde |
| InChIKey | OEHWRIDKBQTMPG-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C=C(C=C2)Cl)C=O |
Computed by PubChem (NCBI)