CAS 16296-90-5 appears in our catalog under these names: 1-(5-Chlorobenzo(b)thiophen-3-yl)ethanone, 95+%, 1-(5-Chlorobenzo[b]thiophen-3-yl)ethanone, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 1g.
1-(5-chloro-1-benzothiophen-3-yl)ethanone (CAS 16296-90-5) is a chemical compound with the molecular formula C10H7ClOS and a molecular weight of 210.68 g/mol. IUPAC name: 1-(5-chloro-1-benzothiophen-3-yl)ethanone. InChIKey: XDMSMJRHOBFWDD-UHFFFAOYSA-N.
| Molecular formula | C10H7ClOS |
|---|---|
| Molecular weight | 210.68 g/mol |
| IUPAC name | 1-(5-chloro-1-benzothiophen-3-yl)ethanone |
| InChIKey | XDMSMJRHOBFWDD-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CSC2=C1C=C(C=C2)Cl |
Computed by PubChem (NCBI)