CAS 1820647-73-1 is the registry number for 7-Chloro-3-methyl-1-benzothiophene-2-carbaldehyde. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
7-chloro-3-methyl-1-benzothiophene-2-carbaldehyde (CAS 1820647-73-1) is a chemical compound with the molecular formula C10H7ClOS and a molecular weight of 210.68 g/mol. IUPAC name: 7-chloro-3-methyl-1-benzothiophene-2-carbaldehyde. InChIKey: DORBCKQBLMFKQN-UHFFFAOYSA-N.
| Molecular formula | C10H7ClOS |
|---|---|
| Molecular weight | 210.68 g/mol |
| IUPAC name | 7-chloro-3-methyl-1-benzothiophene-2-carbaldehyde |
| InChIKey | DORBCKQBLMFKQN-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C=CC=C2Cl)C=O |
Computed by PubChem (NCBI)