CAS 214977-67-0 is the registry number for 6-Chloro-3-methyl-4H-thiochromen-4-one, 95%. Offered by: AmBeed. Available pack sizes: 1g.
6-chloro-3-methylthiochromen-4-one (CAS 214977-67-0) is a chemical compound with the molecular formula C10H7ClOS and a molecular weight of 210.68 g/mol. IUPAC name: 6-chloro-3-methylthiochromen-4-one. InChIKey: CRMQGFYIVQOSFT-UHFFFAOYSA-N.
| Molecular formula | C10H7ClOS |
|---|---|
| Molecular weight | 210.68 g/mol |
| IUPAC name | 6-chloro-3-methylthiochromen-4-one |
| InChIKey | CRMQGFYIVQOSFT-UHFFFAOYSA-N |
| SMILES | CC1=CSC2=C(C1=O)C=C(C=C2)Cl |
Computed by PubChem (NCBI)