Products 137819-55-7
CAS 137819-55-7 appears in our catalog under these names: Benzoyl Ecgonine Isopropyl Ester, >95% (HPLC), Benzoyl ecgonine isopropyl ester. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 5mg, 2mg, 10mg, 25mg.
Propan-2-yl (1R,2R,3S,5S)-3-benzoyloxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate (CAS 137819-55-7) is a chemical compound with the molecular formula C19H25NO4 and a molecular weight of 331.4 g/mol. IUPAC name: propan-2-yl (1R,2R,3S,5S)-3-benzoyloxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate. InChIKey: NGJWCZYRIKMKEP-VVLHAWIVSA-N.
| Molecular formula | C19H25NO4 |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | propan-2-yl (1R,2R,3S,5S)-3-benzoyloxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
| InChIKey | NGJWCZYRIKMKEP-VVLHAWIVSA-N |
| SMILES | CC(C)OC(=O)[C@@H]1[C@H]2CC[C@H](N2C)C[C@@H]1OC(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)