CAS 2177266-03-2 appears in our catalog under these names: 1'-tert-Butyl 5'-methyl spiro[cyclopentane-1,3'-indoline]-1',5'-dicarboxylate, 95%, 1'-(tert-Butyl) 5'-methyl spiro[cyclopentane-1,3'-indoline]-1',5'-dicarboxylate 95%, 1'-(tert-Butyl) 5'-methyl spiro[cyclopentane-1,3'-indoline]-1',5'-dicarboxylate, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
1-O-tert-butyl 5-O-methyl spiro[2H-indole-3,1'-cyclopentane]-1,5-dicarboxylate (CAS 2177266-03-2) is a chemical compound with the molecular formula C19H25NO4 and a molecular weight of 331.4 g/mol. IUPAC name: 1-O-tert-butyl 5-O-methyl spiro[2H-indole-3,1'-cyclopentane]-1,5-dicarboxylate. InChIKey: HCBDRDUEEKUBFT-UHFFFAOYSA-N.
| Molecular formula | C19H25NO4 |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | 1-O-tert-butyl 5-O-methyl spiro[2H-indole-3,1'-cyclopentane]-1,5-dicarboxylate |
| InChIKey | HCBDRDUEEKUBFT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(CCCC2)C3=C1C=CC(=C3)C(=O)OC |
Computed by PubChem (NCBI)