CAS 910442-59-0 is the registry number for tert-Butyl 6-methoxy-3-oxo-2,3-dihydrospiro[indene-1,4'-piperidine]-1'-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl 6-methoxy-3-oxospiro[2H-indene-1,4'-piperidine]-1'-carboxylate (CAS 910442-59-0) is a chemical compound with the molecular formula C19H25NO4 and a molecular weight of 331.4 g/mol. IUPAC name: tert-butyl 6-methoxy-3-oxospiro[2H-indene-1,4'-piperidine]-1'-carboxylate. InChIKey: ITSMIXTWNSEZAQ-UHFFFAOYSA-N.
| Molecular formula | C19H25NO4 |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | tert-butyl 6-methoxy-3-oxospiro[2H-indene-1,4'-piperidine]-1'-carboxylate |
| InChIKey | ITSMIXTWNSEZAQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CC(=O)C3=C2C=C(C=C3)OC |
Computed by PubChem (NCBI)