CAS 16655-60-0 is the registry number for Atropine Impurity 30. Offered by: Chemat Brand. Available pack sizes: on request.
[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-acetyloxy-2-phenylpropanoate (CAS 16655-60-0) is a chemical compound with the molecular formula C19H25NO4 and a molecular weight of 331.4 g/mol. IUPAC name: [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-acetyloxy-2-phenylpropanoate. InChIKey: FFTQFHULPHYOIS-OQSMONGASA-N.
| Molecular formula | C19H25NO4 |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-acetyloxy-2-phenylpropanoate |
| InChIKey | FFTQFHULPHYOIS-OQSMONGASA-N |
| SMILES | CC(=O)OCC(C1=CC=CC=C1)C(=O)OC2C[C@H]3CC[C@@H](C2)N3C |
Computed by PubChem (NCBI)