CAS 2070009-65-1 is the registry number for (S)-1-tert-Butyl 4-(1-phenylethyl) 5,6-dihydropyridine-1,4(2h)-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
1-O-tert-butyl 4-O-[(1S)-1-phenylethyl] 3,6-dihydro-2H-pyridine-1,4-dicarboxylate (CAS 2070009-65-1) is a chemical compound with the molecular formula C19H25NO4 and a molecular weight of 331.4 g/mol. IUPAC name: 1-O-tert-butyl 4-O-[(1S)-1-phenylethyl] 3,6-dihydro-2H-pyridine-1,4-dicarboxylate. InChIKey: YSRFEKIXDTYWTJ-AWEZNQCLSA-N.
| Molecular formula | C19H25NO4 |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-[(1S)-1-phenylethyl] 3,6-dihydro-2H-pyridine-1,4-dicarboxylate |
| InChIKey | YSRFEKIXDTYWTJ-AWEZNQCLSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1)OC(=O)C2=CCN(CC2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)