CAS 1378260-16-2 is the registry number for 8-Bromo-5,6-dimethylquinoline, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
8-bromo-5,6-dimethylquinoline (CAS 1378260-16-2) is a chemical compound with the molecular formula C11H10BrN and a molecular weight of 236.11 g/mol. IUPAC name: 8-bromo-5,6-dimethylquinoline. InChIKey: BSKRKDXLAPCGEM-UHFFFAOYSA-N.
| Molecular formula | C11H10BrN |
|---|---|
| Molecular weight | 236.11 g/mol |
| IUPAC name | 8-bromo-5,6-dimethylquinoline |
| InChIKey | BSKRKDXLAPCGEM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1C)C=CC=N2)Br |
Computed by PubChem (NCBI)