Products 13788-48-2
CAS 13788-48-2 appears in our catalog under these names: 3-(3,4-Diacetoxyphenyl)-2-propenoic acid, 95% (E), 95% (E), 3-(3,4-Diacetoxyphenyl)acrylic acid, 95% (E). Offered by: Chemat, Ambeed. Available pack sizes: 1g, 5g, 10g, 25g, 100g.
3-(3,4-diacetyloxyphenyl)prop-2-enoic acid (CAS 13788-48-2) is a chemical compound with the molecular formula C13H12O6 and a molecular weight of 264.23 g/mol. IUPAC name: 3-(3,4-diacetyloxyphenyl)prop-2-enoic acid. InChIKey: ZDIYGBWFISUTHI-UHFFFAOYSA-N.
| Molecular formula | C13H12O6 |
|---|---|
| Molecular weight | 264.23 g/mol |
| IUPAC name | 3-(3,4-diacetyloxyphenyl)prop-2-enoic acid |
| InChIKey | ZDIYGBWFISUTHI-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C(C=C1)C=CC(=O)O)OC(=O)C |
Computed by PubChem (NCBI)