CAS 62849-03-0 is the registry number for Ethyl 4-(1,3-dioxaindan-5-yl)-2,4-dioxobutanoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl 4-(1,3-benzodioxol-5-yl)-2,4-dioxobutanoate (CAS 62849-03-0) is a chemical compound with the molecular formula C13H12O6 and a molecular weight of 264.23 g/mol. IUPAC name: ethyl 4-(1,3-benzodioxol-5-yl)-2,4-dioxobutanoate. InChIKey: ZYJILSFACFQGEV-UHFFFAOYSA-N.
| Molecular formula | C13H12O6 |
|---|---|
| Molecular weight | 264.23 g/mol |
| IUPAC name | ethyl 4-(1,3-benzodioxol-5-yl)-2,4-dioxobutanoate |
| InChIKey | ZYJILSFACFQGEV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)CC(=O)C1=CC2=C(C=C1)OCO2 |
Computed by PubChem (NCBI)