CAS 853749-60-7 is the registry number for Methyl (6,7-dihydroxy-4-methyl-2-oxo-2h-chromen-3-yl)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 2-(6,7-dihydroxy-4-methyl-2-oxochromen-3-yl)acetate (CAS 853749-60-7) is a chemical compound with the molecular formula C13H12O6 and a molecular weight of 264.23 g/mol. IUPAC name: methyl 2-(6,7-dihydroxy-4-methyl-2-oxochromen-3-yl)acetate. InChIKey: IHXHDAMLAGCPEJ-UHFFFAOYSA-N.
| Molecular formula | C13H12O6 |
|---|---|
| Molecular weight | 264.23 g/mol |
| IUPAC name | methyl 2-(6,7-dihydroxy-4-methyl-2-oxochromen-3-yl)acetate |
| InChIKey | IHXHDAMLAGCPEJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)OC2=CC(=C(C=C12)O)O)CC(=O)OC |
Computed by PubChem (NCBI)