CAS 66753-79-5 is the registry number for Methyl 6,7–dimethoxy–1–oxo–1H–isochromene–4–carboxylate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
Methyl 6,7-dimethoxy-1-oxoisochromene-4-carboxylate (CAS 66753-79-5) is a chemical compound with the molecular formula C13H12O6 and a molecular weight of 264.23 g/mol. IUPAC name: methyl 6,7-dimethoxy-1-oxoisochromene-4-carboxylate. InChIKey: TUZNCNKIMLFQLX-UHFFFAOYSA-N.
| Molecular formula | C13H12O6 |
|---|---|
| Molecular weight | 264.23 g/mol |
| IUPAC name | methyl 6,7-dimethoxy-1-oxoisochromene-4-carboxylate |
| InChIKey | TUZNCNKIMLFQLX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=COC2=O)C(=O)OC)OC |
Computed by PubChem (NCBI)