Products 66753-79-5

CAS 66753-79-5 is the registry number for Methyl 6,7–dimethoxy–1–oxo–1H–isochromene–4–carboxylate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 6,7-dimethoxy-1-oxoisochromene-4-carboxylate (CAS 66753-79-5) is a chemical compound with the molecular formula C13H12O6 and a molecular weight of 264.23 g/mol. IUPAC name: methyl 6,7-dimethoxy-1-oxoisochromene-4-carboxylate. InChIKey: TUZNCNKIMLFQLX-UHFFFAOYSA-N.

Identity
Molecular formulaC13H12O6
Molecular weight264.23 g/mol
IUPAC namemethyl 6,7-dimethoxy-1-oxoisochromene-4-carboxylate
InChIKeyTUZNCNKIMLFQLX-UHFFFAOYSA-N
SMILESCOC1=C(C=C2C(=C1)C(=COC2=O)C(=O)OC)OC

Computed by PubChem (NCBI)