CAS 198059-76-6 is the registry number for Methyl 6,7-dimethoxy-2-oxo-2H-chromene-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 6,7-dimethoxy-2-oxochromene-3-carboxylate (CAS 198059-76-6) is a chemical compound with the molecular formula C13H12O6 and a molecular weight of 264.23 g/mol. IUPAC name: methyl 6,7-dimethoxy-2-oxochromene-3-carboxylate. InChIKey: YRTAHQGXLXKNGU-UHFFFAOYSA-N.
| Molecular formula | C13H12O6 |
|---|---|
| Molecular weight | 264.23 g/mol |
| IUPAC name | methyl 6,7-dimethoxy-2-oxochromene-3-carboxylate |
| InChIKey | YRTAHQGXLXKNGU-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C=C(C(=O)O2)C(=O)OC)OC |
Computed by PubChem (NCBI)