Products 1378831-60-7

CAS 1378831-60-7 appears in our catalog under these names: Benzo(d)isothiazole-4-carboxylic acid, 97%, 1,2-Benzothiazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

1,2-benzothiazole-4-carboxylic acid (CAS 1378831-60-7) is a chemical compound with the molecular formula C8H5NO2S and a molecular weight of 179.20 g/mol. IUPAC name: 1,2-benzothiazole-4-carboxylic acid. InChIKey: XSWJXMIWKAYUKN-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5NO2S
Molecular weight179.20 g/mol
IUPAC name1,2-benzothiazole-4-carboxylic acid
InChIKeyXSWJXMIWKAYUKN-UHFFFAOYSA-N
SMILESC1=CC(=C2C=NSC2=C1)C(=O)O

Computed by PubChem (NCBI)