Products 1379179-47-1
CAS 1379179-47-1 is the registry number for 3-(2-Chloro-1H-imidazol-5-yl)pyridine, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
3-(2-chloro-1H-imidazol-5-yl)pyridine (CAS 1379179-47-1) is a chemical compound with the molecular formula C8H6ClN3 and a molecular weight of 179.60 g/mol. IUPAC name: 3-(2-chloro-1H-imidazol-5-yl)pyridine. InChIKey: WDWACDUQPKBBDM-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3 |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 3-(2-chloro-1H-imidazol-5-yl)pyridine |
| InChIKey | WDWACDUQPKBBDM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=CN=C(N2)Cl |
Computed by PubChem (NCBI)