CAS 1379186-26-1 is the registry number for 6-(Azetidin-1-yl)-9H-purine. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
6-(azetidin-1-yl)-7H-purine (CAS 1379186-26-1) is a chemical compound with the molecular formula C8H9N5 and a molecular weight of 175.19 g/mol. IUPAC name: 6-(azetidin-1-yl)-7H-purine. InChIKey: ACPXQMYLXLKGKU-UHFFFAOYSA-N.
| Molecular formula | C8H9N5 |
|---|---|
| Molecular weight | 175.19 g/mol |
| IUPAC name | 6-(azetidin-1-yl)-7H-purine |
| InChIKey | ACPXQMYLXLKGKU-UHFFFAOYSA-N |
| SMILES | C1CN(C1)C2=NC=NC3=C2NC=N3 |
Computed by PubChem (NCBI)