Products 1379298-46-0
CAS 1379298-46-0 appears in our catalog under these names: tert-Butyl 3-bromoisonicotinate, 97%, tert-Butyl 3-bromopyridine-4-carboxylate, 98%, tert-Butyl 3-bromoisonicotinate, 98%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 3-bromopyridine-4-carboxylate (CAS 1379298-46-0) is a chemical compound with the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. IUPAC name: tert-butyl 3-bromopyridine-4-carboxylate. InChIKey: UDXALDNVYKALHX-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO2 |
|---|---|
| Molecular weight | 258.11 g/mol |
| IUPAC name | tert-butyl 3-bromopyridine-4-carboxylate |
| InChIKey | UDXALDNVYKALHX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=NC=C1)Br |
Computed by PubChem (NCBI)