CAS 1379309-01-9 appears in our catalog under these names: 3-Bromo-4-methyl-2-nitropyridine, 95%, 3-Bromo-4-methyl-2-nitropyridine 95%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 25mg, 50mg, 100mg, 250mg, 1g.
3-bromo-4-methyl-2-nitropyridine (CAS 1379309-01-9) is a chemical compound with the molecular formula C6H5BrN2O2 and a molecular weight of 217.02 g/mol. IUPAC name: 3-bromo-4-methyl-2-nitropyridine. InChIKey: XUHPAVOHTMBAKI-UHFFFAOYSA-N.
| Molecular formula | C6H5BrN2O2 |
|---|---|
| Molecular weight | 217.02 g/mol |
| IUPAC name | 3-bromo-4-methyl-2-nitropyridine |
| InChIKey | XUHPAVOHTMBAKI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC=C1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)