CAS 1379344-14-5 is the registry number for methyl 2-chloro-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-chloro-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylate (CAS 1379344-14-5) is a chemical compound with the molecular formula C8H6ClN3O2 and a molecular weight of 211.60 g/mol. IUPAC name: methyl 2-chloro-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylate. InChIKey: UMFBBZSEFIBVJL-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3O2 |
|---|---|
| Molecular weight | 211.60 g/mol |
| IUPAC name | methyl 2-chloro-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylate |
| InChIKey | UMFBBZSEFIBVJL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=CN=C(N=C2N1)Cl |
Computed by PubChem (NCBI)