CAS 137975-18-9 appears in our catalog under these names: (4-Aminophenyl)(3,4-dihydroquinolin-1(2h)-yl)methanone, 95%, (4-Aminophenyl)(3,4-dihydro-1(2H)-quinolinyl)-methanone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 5g, 0,5g.
(4-aminophenyl)-(3,4-dihydro-2H-quinolin-1-yl)methanone (CAS 137975-18-9) is a chemical compound with the molecular formula C16H16N2O and a molecular weight of 252.31 g/mol. IUPAC name: (4-aminophenyl)-(3,4-dihydro-2H-quinolin-1-yl)methanone. InChIKey: KZYCNMIZJOEZLC-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O |
|---|---|
| Molecular weight | 252.31 g/mol |
| IUPAC name | (4-aminophenyl)-(3,4-dihydro-2H-quinolin-1-yl)methanone |
| InChIKey | KZYCNMIZJOEZLC-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=CC=C2N(C1)C(=O)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)