CAS 953725-03-6 appears in our catalog under these names: 2-(4-Aminophenyl)-1-(2,3-dihydro-1h-indol-1-yl)ethan-1-one, 95%, 2-(4-Aminophenyl)-1-(2,3-dihydro-1H-indol-1-yl)ethan-1-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-(4-aminophenyl)-1-(2,3-dihydroindol-1-yl)ethanone (CAS 953725-03-6) is a chemical compound with the molecular formula C16H16N2O and a molecular weight of 252.31 g/mol. IUPAC name: 2-(4-aminophenyl)-1-(2,3-dihydroindol-1-yl)ethanone. InChIKey: IGTFWJOHKLVUKX-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O |
|---|---|
| Molecular weight | 252.31 g/mol |
| IUPAC name | 2-(4-aminophenyl)-1-(2,3-dihydroindol-1-yl)ethanone |
| InChIKey | IGTFWJOHKLVUKX-UHFFFAOYSA-N |
| SMILES | C1CN(C2=CC=CC=C21)C(=O)CC3=CC=C(C=C3)N |
Computed by PubChem (NCBI)