CAS 292058-55-0 is the registry number for 5-(5-Ethyl-1,3-benzoxazol-2-yl)-2-methylaniline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-(5-ethyl-1,3-benzoxazol-2-yl)-2-methylaniline (CAS 292058-55-0) is a chemical compound with the molecular formula C16H16N2O and a molecular weight of 252.31 g/mol. IUPAC name: 5-(5-ethyl-1,3-benzoxazol-2-yl)-2-methylaniline. InChIKey: LZQRAZOLPLCAMT-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O |
|---|---|
| Molecular weight | 252.31 g/mol |
| IUPAC name | 5-(5-ethyl-1,3-benzoxazol-2-yl)-2-methylaniline |
| InChIKey | LZQRAZOLPLCAMT-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(C=C1)OC(=N2)C3=CC(=C(C=C3)C)N |
Computed by PubChem (NCBI)