CAS 727374-25-6 is the registry number for 1-(4-Ethylphenyl)-4,6-dimethyl-2-oxo-1,2-dihydropyridine-3-carbonitrile, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(4-ethylphenyl)-4,6-dimethyl-2-oxopyridine-3-carbonitrile (CAS 727374-25-6) is a chemical compound with the molecular formula C16H16N2O and a molecular weight of 252.31 g/mol. IUPAC name: 1-(4-ethylphenyl)-4,6-dimethyl-2-oxopyridine-3-carbonitrile. InChIKey: LZZMANSKGWMVEK-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O |
|---|---|
| Molecular weight | 252.31 g/mol |
| IUPAC name | 1-(4-ethylphenyl)-4,6-dimethyl-2-oxopyridine-3-carbonitrile |
| InChIKey | LZZMANSKGWMVEK-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)N2C(=CC(=C(C2=O)C#N)C)C |
Computed by PubChem (NCBI)