CAS 2279122-77-7 is the registry number for 5-Amino-biphenyl-3-carboxylic acid cyclopropylamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-amino-N-cyclopropyl-5-phenylbenzamide (CAS 2279122-77-7) is a chemical compound with the molecular formula C16H16N2O and a molecular weight of 252.31 g/mol. IUPAC name: 3-amino-N-cyclopropyl-5-phenylbenzamide. InChIKey: HJYPBJVMSCWPEV-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O |
|---|---|
| Molecular weight | 252.31 g/mol |
| IUPAC name | 3-amino-N-cyclopropyl-5-phenylbenzamide |
| InChIKey | HJYPBJVMSCWPEV-UHFFFAOYSA-N |
| SMILES | C1CC1NC(=O)C2=CC(=CC(=C2)C3=CC=CC=C3)N |
Computed by PubChem (NCBI)