Products 1379824-42-6

CAS 1379824-42-6 is the registry number for (R,E)-3-Amino-6-phenylhex-5-enoic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(E,3R)-3-amino-6-phenylhex-5-enoic acid;hydrochloride (CAS 1379824-42-6) is a chemical compound with the molecular formula C12H16ClNO2 and a molecular weight of 241.71 g/mol. IUPAC name: (E,3R)-3-amino-6-phenylhex-5-enoic acid;hydrochloride. InChIKey: OREIHEVSPFNFKW-QPJFETGUSA-N.

Identity
Molecular formulaC12H16ClNO2
Molecular weight241.71 g/mol
IUPAC name(E,3R)-3-amino-6-phenylhex-5-enoic acid;hydrochloride
InChIKeyOREIHEVSPFNFKW-QPJFETGUSA-N
SMILESC1=CC=C(C=C1)/C=C/C[C@H](CC(=O)O)N.Cl

Computed by PubChem (NCBI)