Products 270596-35-5

CAS 270596-35-5 is the registry number for (R)-3-Amino-(6-phenyl)-5-hexenoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

(E,3R)-3-amino-6-phenylhex-5-enoic acid;hydrochloride (CAS 270596-35-5) is a chemical compound with the molecular formula C12H16ClNO2 and a molecular weight of 241.71 g/mol. IUPAC name: (E,3R)-3-amino-6-phenylhex-5-enoic acid;hydrochloride. InChIKey: OREIHEVSPFNFKW-QPJFETGUSA-N.

Identity
Molecular formulaC12H16ClNO2
Molecular weight241.71 g/mol
IUPAC name(E,3R)-3-amino-6-phenylhex-5-enoic acid;hydrochloride
InChIKeyOREIHEVSPFNFKW-QPJFETGUSA-N
SMILESC1=CC=C(C=C1)/C=C/C[C@H](CC(=O)O)N.Cl

Computed by PubChem (NCBI)