CAS 270596-35-5 is the registry number for (R)-3-Amino-(6-phenyl)-5-hexenoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.
(E,3R)-3-amino-6-phenylhex-5-enoic acid;hydrochloride (CAS 270596-35-5) is a chemical compound with the molecular formula C12H16ClNO2 and a molecular weight of 241.71 g/mol. IUPAC name: (E,3R)-3-amino-6-phenylhex-5-enoic acid;hydrochloride. InChIKey: OREIHEVSPFNFKW-QPJFETGUSA-N.
| Molecular formula | C12H16ClNO2 |
|---|---|
| Molecular weight | 241.71 g/mol |
| IUPAC name | (E,3R)-3-amino-6-phenylhex-5-enoic acid;hydrochloride |
| InChIKey | OREIHEVSPFNFKW-QPJFETGUSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C[C@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)