Products 1379971-06-8
CAS 1379971-06-8 appears in our catalog under these names: 4-Chlorophenylalaninol hydrochloride, 98%, 4–Chlorophenylalaninol Hydrochloride, 4-chlorophenylalaninol hcl, 4-Chlorophenylalaninol Hydrochloride, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat. Available pack sizes: 5g, 1g, 2,5g, 250mg.
2-amino-3-(4-chlorophenyl)propan-1-ol;hydrochloride (CAS 1379971-06-8) is a chemical compound with the molecular formula C9H13Cl2NO and a molecular weight of 222.11 g/mol. IUPAC name: 2-amino-3-(4-chlorophenyl)propan-1-ol;hydrochloride. InChIKey: VLDWUIKCXWULET-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl2NO |
|---|---|
| Molecular weight | 222.11 g/mol |
| IUPAC name | 2-amino-3-(4-chlorophenyl)propan-1-ol;hydrochloride |
| InChIKey | VLDWUIKCXWULET-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(CO)N)Cl.Cl |
Computed by PubChem (NCBI)