CAS 1380324-08-2 is the registry number for 2'-Chloro-4-hydroxy-5',6-dimethyl-2H-[1,4'-bipyridin]-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2-chloro-5-methyl-4-pyridinyl)-4-hydroxy-6-methylpyridin-2-one (CAS 1380324-08-2) is a chemical compound with the molecular formula C12H11ClN2O2 and a molecular weight of 250.68 g/mol. IUPAC name: 1-(2-chloro-5-methyl-4-pyridinyl)-4-hydroxy-6-methylpyridin-2-one. InChIKey: XOLDUYABNNRUGL-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O2 |
|---|---|
| Molecular weight | 250.68 g/mol |
| IUPAC name | 1-(2-chloro-5-methyl-4-pyridinyl)-4-hydroxy-6-methylpyridin-2-one |
| InChIKey | XOLDUYABNNRUGL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=O)N1C2=CC(=NC=C2C)Cl)O |
Computed by PubChem (NCBI)