CAS 24786-56-9 appears in our catalog under these names: 5-Bromo-1-ethyl-1H-1,3-benzodiazol-2-amine, 95%, 5-Bromo-1-ethyl-1H-1,3-benzodiazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
5-bromo-1-ethylbenzimidazol-2-amine (CAS 24786-56-9) is a chemical compound with the molecular formula C9H10BrN3 and a molecular weight of 240.10 g/mol. IUPAC name: 5-bromo-1-ethylbenzimidazol-2-amine. InChIKey: PKXDSPHJYREQRJ-UHFFFAOYSA-N.
| Molecular formula | C9H10BrN3 |
|---|---|
| Molecular weight | 240.10 g/mol |
| IUPAC name | 5-bromo-1-ethylbenzimidazol-2-amine |
| InChIKey | PKXDSPHJYREQRJ-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)Br)N=C1N |
Computed by PubChem (NCBI)