Products 1380586-66-2
CAS 1380586-66-2 is the registry number for 1-(5,8-Dihydro-1,7-naphthyridin-7(6H)-yl)ethan-1-one, 95%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 1g, 250mg, 100mg, on request.
1-(6,8-dihydro-5H-1,7-naphthyridin-7-yl)ethanone (CAS 1380586-66-2) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 176.21 g/mol. IUPAC name: 1-(6,8-dihydro-5H-1,7-naphthyridin-7-yl)ethanone. InChIKey: RSTMARJPSOEPMW-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 1-(6,8-dihydro-5H-1,7-naphthyridin-7-yl)ethanone |
| InChIKey | RSTMARJPSOEPMW-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCC2=C(C1)N=CC=C2 |
Computed by PubChem (NCBI)